C21H26N2S2 — CID 15725336
10-[2-(1-methylpiperidin-3-yl)ethyl]-2-methylsulfanylphenothiazine (PubChem CID 15725336) has the molecular formula C21H26N2S2 and a molecular weight of 370.59 g/mol. Its IUPAC name is 10-[2-(1-methylpiperidin-3-yl)ethyl]-2-methylsulfanylphenothiazine.
| Compound Name | 10-[2-(1-methylpiperidin-3-yl)ethyl]-2-methylsulfanylphenothiazine |
|---|---|
| PubChem CID | 15725336 |
| Molecular Formula | C21H26N2S2 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 10-[2-(1-methylpiperidin-3-yl)ethyl]-2-methylsulfanylphenothiazine |
| SMILES | CSc1ccc2c(c1)N(CCC1CCCN(C)C1)c1ccccc1S2 |
| InChI | InChI=1S/C21H26N2S2/c1-22-12-5-6-16(15-22)11-13-23-18-7-3-4-8-20(18)25-21-10-9-17(24-2)14-19(21)23/h3-4,7-10,14,16H,5-6,11-13,15H2,1-2H3 |
| InChIKey | RPLQPJCWDWQQCO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |