C22H26N2OS2 — CID 91748186
1-[2-[2-(2-methylsulfanylphenothiazin-10-yl)ethyl]piperidin-1-yl]ethanone (PubChem CID 91748186) has the molecular formula C22H26N2OS2 and a molecular weight of 398.60 g/mol. Its IUPAC name is 1-[2-[2-(2-methylsulfanylphenothiazin-10-yl)ethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[2-[2-(2-methylsulfanylphenothiazin-10-yl)ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91748186 |
| Molecular Formula | C22H26N2OS2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[2-[2-(2-methylsulfanylphenothiazin-10-yl)ethyl]piperidin-1-yl]ethanone |
| SMILES | CSc1ccc2c(c1)N(CCC1CCCCN1C(C)=O)c1ccccc1S2 |
| InChI | InChI=1S/C22H26N2OS2/c1-16(25)23-13-6-5-7-17(23)12-14-24-19-8-3-4-9-21(19)27-22-11-10-18(26-2)15-20(22)24/h3-4,8-11,15,17H,5-7,12-14H2,1-2H3 |
| InChIKey | YCDMQFVMNFYJQK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |