C19H27N3O2S — CID 95714212
(2R)-N-(3-methylsulfanylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide (PubChem CID 95714212) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is (2R)-N-(3-methylsulfanylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | (2R)-N-(3-methylsulfanylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95714212 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R)-N-(3-methylsulfanylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide |
| SMILES | CSc1cccc(NC(=O)N2CCCC[C@@H]2CCN2CCCC2=O)c1 |
| InChI | InChI=1S/C19H27N3O2S/c1-25-17-8-4-6-15(14-17)20-19(24)22-12-3-2-7-16(22)10-13-21-11-5-9-18(21)23/h4,6,8,14,16H,2-3,5,7,9-13H2,1H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | VNOWKALSERQEPA-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |