C20H28FN3O2 — CID 56890665
N-[2-(4-fluorophenyl)ethyl]-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide (PubChem CID 56890665) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 56890665 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[2-(2-oxopyrrolidin-1-yl)ethyl]piperidine-1-carboxamide |
| SMILES | O=C1CCCN1CCC1CCCCN1C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN3O2/c21-17-8-6-16(7-9-17)10-12-22-20(26)24-14-2-1-4-18(24)11-15-23-13-3-5-19(23)25/h6-9,18H,1-5,10-15H2,(H,22,26) |
| InChIKey | TUUWRZPUUZFYCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |