C18H23FN4O — CID 95722375
(2S)-N-[(4-fluorophenyl)methyl]-2-(2-imidazol-1-ylethyl)piperidine-1-carboxamide (PubChem CID 95722375) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-2-(2-imidazol-1-ylethyl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-2-(2-imidazol-1-ylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95722375 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-2-(2-imidazol-1-ylethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCCC[C@H]1CCn1ccnc1 |
| InChI | InChI=1S/C18H23FN4O/c19-16-6-4-15(5-7-16)13-21-18(24)23-10-2-1-3-17(23)8-11-22-12-9-20-14-22/h4-7,9,12,14,17H,1-3,8,10-11,13H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | HJEDRYONUYERME-KRWDZBQOSA-N |
| XLogP | 3.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |