C24H31BrN2S2 — CID 155234459
10-[2-(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)ethyl]-2-methylsulfanylphenothiazine bromide (PubChem CID 155234459) has the molecular formula C24H31BrN2S2 and a molecular weight of 491.56 g/mol. Its IUPAC name is 10-[2-(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)ethyl]-2-methylsulfanylphenothiazine bromide.
| Compound Name | 10-[2-(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)ethyl]-2-methylsulfanylphenothiazine bromide |
|---|---|
| PubChem CID | 155234459 |
| Molecular Formula | C24H31BrN2S2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 10-[2-(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)ethyl]-2-methylsulfanylphenothiazine bromide |
| SMILES | C=CC[N+]1(C)CCCCC1CCN1c2ccccc2Sc2ccc(SC)cc21.[Br-] |
| InChI | InChI=1S/C24H31N2S2.BrH/c1-4-16-26(2)17-8-7-9-19(26)14-15-25-21-10-5-6-11-23(21)28-24-13-12-20(27-3)18-22(24)25;/h4-6,10-13,18-19H,1,7-9,14-17H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | XMGUZLPCARMVRN-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|