C35H40F5N3O3 — CID 164922942
2-[6-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-1,6-diazecan-1-yl]acetic acid (PubChem CID 164922942) has the molecular formula C35H40F5N3O3 and a molecular weight of 645.71 g/mol. Its IUPAC name is 2-[6-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-1,6-diazecan-1-yl]acetic acid.
| Compound Name | 2-[6-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-1,6-diazecan-1-yl]acetic acid |
|---|---|
| PubChem CID | 164922942 |
| Molecular Formula | C35H40F5N3O3 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | 2-[6-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-1,6-diazecan-1-yl]acetic acid |
| SMILES | C[C@@H]1Cc2cc(OCc3ccccc3)ccc2C(c2c(F)cc(N3CCCCN(CC(=O)O)CCCC3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C35H40F5N3O3/c1-24-17-26-18-28(46-22-25-9-3-2-4-10-25)11-12-29(26)34(43(24)23-35(38,39)40)33-30(36)19-27(20-31(33)37)42-15-7-5-13-41(21-32(44)45)14-6-8-16-42/h2-4,9-12,18-20,24,34H,5-8,13-17,21-23H2,1H3,(H,44,45)/t24-,34?/m1/s1 |
| InChIKey | LGFPIUYZERWVBA-CPPKSAKYSA-N |
| XLogP | 7.21 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|