C38H46F5N3O — CID 164923955
4-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-4,12-diazaspiro[7.7]pentadecane (PubChem CID 164923955) has the molecular formula C38H46F5N3O and a molecular weight of 655.80 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-4,12-diazaspiro[7.7]pentadecane.
| Compound Name | 4-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-4,12-diazaspiro[7.7]pentadecane |
|---|---|
| PubChem CID | 164923955 |
| Molecular Formula | C38H46F5N3O |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | 4-[3,5-difluoro-4-[(3R)-3-methyl-6-phenylmethoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-4,12-diazaspiro[7.7]pentadecane |
| SMILES | C[C@@H]1Cc2cc(OCc3ccccc3)ccc2C(c2c(F)cc(N3CCCC4(CCCNCCC4)CCC3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C38H46F5N3O/c1-27-21-29-22-31(47-25-28-9-3-2-4-10-28)11-12-32(29)36(46(27)26-38(41,42)43)35-33(39)23-30(24-34(35)40)45-19-7-15-37(16-8-20-45)13-5-17-44-18-6-14-37/h2-4,9-12,22-24,27,36,44H,5-8,13-21,25-26H2,1H3/t27-,36?/m1/s1 |
| InChIKey | YPWAFIBKIHTYSI-YEBNLHQGSA-N |
| XLogP | 8.97 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|