C7H8ClNO5S2 — CID 164927394
2-(hydroxymethyl)-4-sulfamoylbenzenesulfonyl chloride (PubChem CID 164927394) has the molecular formula C7H8ClNO5S2 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-sulfamoylbenzenesulfonyl chloride.
| Compound Name | 2-(hydroxymethyl)-4-sulfamoylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 164927394 |
| Molecular Formula | C7H8ClNO5S2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | 2-(hydroxymethyl)-4-sulfamoylbenzenesulfonyl chloride |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Cl)c(CO)c1 |
| InChI | InChI=1S/C7H8ClNO5S2/c8-15(11,12)7-2-1-6(16(9,13)14)3-5(7)4-10/h1-3,10H,4H2,(H2,9,13,14) |
| InChIKey | FNBUFCFIZWGHTK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |