C46H28N6 — CID 164927507
5-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2-(7-phenylindolo[2,3-b]carbazol-5-yl)benzonitrile (PubChem CID 164927507) has the molecular formula C46H28N6 and a molecular weight of 674.83 g/mol. Its IUPAC name is 5-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2-(7-phenylindolo[2,3-b]carbazol-5-yl)benzonitrile.
| Compound Name | 5-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2-(7-phenylindolo[2,3-b]carbazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 164927507 |
| Molecular Formula | C46H28N6 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | 5-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2-(7-phenylindolo[2,3-b]carbazol-5-yl)benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6cc54)c(C#N)c3)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C46H28N6/c47-29-33-26-32(46-49-44(30-14-4-1-5-15-30)48-45(50-46)31-16-6-2-7-17-31)24-25-39(33)52-41-23-13-11-21-36(41)38-27-37-35-20-10-12-22-40(35)51(42(37)28-43(38)52)34-18-8-3-9-19-34/h1-28H/i1D,2D,4D,5D,6D,7D,14D,15D,16D,17D |
| InChIKey | LJVUUAMWBYJGNI-RIMVHXCBSA-N |
| XLogP | 10.94 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |