C58H36N6 — CID 164927552
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-bis[2-(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]benzonitrile (PubChem CID 164927552) has the molecular formula C58H36N6 and a molecular weight of 827.03 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-bis[2-(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-bis[2-(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 164927552 |
| Molecular Formula | C58H36N6 |
| Molecular Weight | 827.03 g/mol |
| Exact Mass | 826.36 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-bis[2-(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c4ccccc4n(-c4cc(-n5c6ccccc6c6ccc(-c7c([2H])c([2H])c([2H])c([2H])c7[2H])cc65)c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4C#N)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C58H36N6/c59-37-44-33-49(58-61-56(40-21-9-3-10-22-40)60-57(62-58)41-23-11-4-12-24-41)55(64-51-28-16-14-26-46(51)48-32-30-43(35-54(48)64)39-19-7-2-8-20-39)36-52(44)63-50-27-15-13-25-45(50)47-31-29-42(34-53(47)63)38-17-5-1-6-18-38/h1-36H/i1D,2D,5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | JTSQBRIJODKLNK-TZAYFOPYSA-N |
| XLogP | 14.27 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.03 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |