C49H32N4 — CID 171720916
9-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 171720916) has the molecular formula C49H32N4 and a molecular weight of 686.88 g/mol. Its IUPAC name is 9-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 171720916 |
| Molecular Formula | C49H32N4 |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 9-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-n3c4ccccc4c4ccccc43)c(-c3nc(-c4ccccc4)nc(-c4ccc5cc(-c6c([2H])c([2H])c([2H])c([2H])c6[2H])ccc5c4)n3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C49H32N4/c1-4-14-33(15-5-1)36-24-25-38-31-40(27-26-37(38)30-36)48-50-47(35-18-8-3-9-19-35)51-49(52-48)43-32-39(34-16-6-2-7-17-34)28-29-46(43)53-44-22-12-10-20-41(44)42-21-11-13-23-45(42)53/h1-32H/i1D,2D,4D,5D,6D,7D,14D,15D,16D,17D |
| InChIKey | FPTXUNBRZZZXPZ-RIMVHXCBSA-N |
| XLogP | 12.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |