C43H28N4 — CID 157084112
9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]naphthalen-1-yl]carbazole (PubChem CID 157084112) has the molecular formula C43H28N4 and a molecular weight of 605.76 g/mol. Its IUPAC name is 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]naphthalen-1-yl]carbazole.
| Compound Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]naphthalen-1-yl]carbazole |
|---|---|
| PubChem CID | 157084112 |
| Molecular Formula | C43H28N4 |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]naphthalen-1-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)c4ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C43H28N4/c1-3-13-29(14-4-1)30-23-25-32(26-24-30)42-44-41(31-15-5-2-6-16-31)45-43(46-42)37-27-28-40(34-18-8-7-17-33(34)37)47-38-21-11-9-19-35(38)36-20-10-12-22-39(36)47/h1-28H/i2D,5D,6D,15D,16D |
| InChIKey | JTVJVRIOEHPOAJ-KLZHWEBPSA-N |
| XLogP | 10.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |