C39H26N4 — CID 168801624
9-[2-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole (PubChem CID 168801624) has the molecular formula C39H26N4 and a molecular weight of 555.70 g/mol. Its IUPAC name is 9-[2-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole.
| Compound Name | 9-[2-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 168801624 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 9-[2-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4-n4c5ccccc5c5ccccc54)cc3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H26N4/c1-3-13-28(14-4-1)37-40-38(29-15-5-2-6-16-29)42-39(41-37)30-25-23-27(24-26-30)31-17-7-10-20-34(31)43-35-21-11-8-18-32(35)33-19-9-12-22-36(33)43/h1-26H/i1D,3D,4D,13D,14D |
| InChIKey | YKHBGTHLJAMEBO-CULCNESPSA-N |
| XLogP | 9.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |