C54H35N7 — CID 162710811
9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1-phenylcarbazole (PubChem CID 162710811) has the molecular formula C54H35N7 and a molecular weight of 786.95 g/mol. Its IUPAC name is 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1-phenylcarbazole.
| Compound Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1-phenylcarbazole |
|---|---|
| PubChem CID | 162710811 |
| Molecular Formula | C54H35N7 |
| Molecular Weight | 786.95 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5cccc(-c6ccccc6)c54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H35N7/c1-6-19-36(20-7-1)42-30-18-31-44-43-29-16-17-32-46(43)61(48(42)44)47-34-33-41(53-57-49(37-21-8-2-9-22-37)55-50(58-53)38-23-10-3-11-24-38)35-45(47)54-59-51(39-25-12-4-13-26-39)56-52(60-54)40-27-14-5-15-28-40/h1-35H/i2D,8D,9D,21D,22D |
| InChIKey | QNBDLGMDYNYXHE-MLGIRIDSSA-N |
| XLogP | 12.82 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.95 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |