C32H28F4N4O4S — CID 164929764
1-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-(4-methylsulfonylphenyl)but-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-yn-1-one (PubChem CID 164929764) has the molecular formula C32H28F4N4O4S and a molecular weight of 640.66 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-(4-methylsulfonylphenyl)but-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-(4-methylsulfonylphenyl)but-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 164929764 |
| Molecular Formula | C32H28F4N4O4S |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | 1-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-(4-methylsulfonylphenyl)but-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccc(S(C)(=O)=O)cc3)c3ccc4n[nH]c(F)c4c3)cn2)C1 |
| InChI | InChI=1S/C32H28F4N4O4S/c1-3-5-29(41)40-15-4-6-23(19-40)44-28-14-10-22(18-37-28)30(21-9-13-27-25(16-21)31(33)39-38-27)26(17-32(34,35)36)20-7-11-24(12-8-20)45(2,42)43/h7-14,16,18,23H,4,6,15,17,19H2,1-2H3,(H,38,39)/b30-26-/t23-/m1/s1 |
| InChIKey | WCLPEKMXYOWYJT-PCKLGSBKSA-N |
| XLogP | 5.81 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|