C52H47BN4 — CID 164930410
N,N-bis(4-tert-butylphenyl)-11-methyl-8,17-diphenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15(20),16,18,21-decaen-5-amine (PubChem CID 164930410) has the molecular formula C52H47BN4 and a molecular weight of 738.79 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-11-methyl-8,17-diphenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15(20),16,18,21-decaen-5-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-11-methyl-8,17-diphenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15(20),16,18,21-decaen-5-amine |
|---|---|
| PubChem CID | 164930410 |
| Molecular Formula | C52H47BN4 |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 738.39 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-11-methyl-8,17-diphenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15(20),16,18,21-decaen-5-amine |
| SMILES | Cc1cc2c3c(c1)-n1c(nc4ccc(-c5ccccc5)cc41)B3c1ccc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)cc1N2c1ccccc1 |
| InChI | InChI=1S/C52H47BN4/c1-34-30-47-49-48(31-34)57-46-32-36(35-14-10-8-11-15-35)18-29-44(46)54-50(57)53(49)43-28-27-42(33-45(43)56(47)39-16-12-9-13-17-39)55(40-23-19-37(20-24-40)51(2,3)4)41-25-21-38(22-26-41)52(5,6)7/h8-33H,1-7H3 |
| InChIKey | HYYAOIYEKOUMBH-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|