C49H49BN4 — CID 164930520
11-tert-butyl-N,N-bis(4-tert-butylphenyl)-8-phenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15,17,19,21-decaen-5-amine (PubChem CID 164930520) has the molecular formula C49H49BN4 and a molecular weight of 704.77 g/mol. Its IUPAC name is 11-tert-butyl-N,N-bis(4-tert-butylphenyl)-8-phenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15,17,19,21-decaen-5-amine.
| Compound Name | 11-tert-butyl-N,N-bis(4-tert-butylphenyl)-8-phenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15,17,19,21-decaen-5-amine |
|---|---|
| PubChem CID | 164930520 |
| Molecular Formula | C49H49BN4 |
| Molecular Weight | 704.77 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | 11-tert-butyl-N,N-bis(4-tert-butylphenyl)-8-phenyl-8,14,21-triaza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.015,20]tricosa-2(7),3,5,9,11,13(23),15,17,19,21-decaen-5-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)N(c2ccccc2)c2cc(C(C)(C)C)cc4c2B3c2nc3ccccc3n2-4)cc1 |
| InChI | InChI=1S/C49H49BN4/c1-47(2,3)32-19-23-36(24-20-32)52(37-25-21-33(22-26-37)48(4,5)6)38-27-28-39-42(31-38)53(35-15-11-10-12-16-35)43-29-34(49(7,8)9)30-44-45(43)50(39)46-51-40-17-13-14-18-41(40)54(44)46/h10-31H,1-9H3 |
| InChIKey | PKMVORLGMQRLHQ-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.77 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|