C24H11BN4O2 — CID 164931565
2-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-6-isocyanopyrimidine-4-carbonitrile (PubChem CID 164931565) has the molecular formula C24H11BN4O2 and a molecular weight of 398.19 g/mol. Its IUPAC name is 2-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-6-isocyanopyrimidine-4-carbonitrile.
| Compound Name | 2-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-6-isocyanopyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 164931565 |
| Molecular Formula | C24H11BN4O2 |
| Molecular Weight | 398.19 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-6-isocyanopyrimidine-4-carbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)nc(-c2cc3c4c(c2)Oc2ccccc2B4c2ccccc2O3)n1 |
| InChI | InChI=1S/C24H11BN4O2/c1-27-22-12-15(13-26)28-24(29-22)14-10-20-23-21(11-14)31-19-9-5-3-7-17(19)25(23)16-6-2-4-8-18(16)30-20/h2-12H |
| InChIKey | WKYRBIOGHOWLBA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|