C22H12BN5O2 — CID 164931693
4-amino-6-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-1,3,5-triazine-2-carbonitrile (PubChem CID 164931693) has the molecular formula C22H12BN5O2 and a molecular weight of 389.18 g/mol. Its IUPAC name is 4-amino-6-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-1,3,5-triazine-2-carbonitrile.
| Compound Name | 4-amino-6-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-1,3,5-triazine-2-carbonitrile |
|---|---|
| PubChem CID | 164931693 |
| Molecular Formula | C22H12BN5O2 |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-amino-6-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-1,3,5-triazine-2-carbonitrile |
| SMILES | N#Cc1nc(N)nc(-c2cc3c4c(c2)Oc2ccccc2B4c2ccccc2O3)n1 |
| InChI | InChI=1S/C22H12BN5O2/c24-11-19-26-21(28-22(25)27-19)12-9-17-20-18(10-12)30-16-8-4-2-6-14(16)23(20)13-5-1-3-7-15(13)29-17/h1-10H,(H2,25,26,27,28) |
| InChIKey | APVCLIGVVUOVHL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|