C22H42O3 — CID 164934214
4,4,5,5,6,6-hexa(propan-2-yl)-1,3-dioxan-2-one (PubChem CID 164934214) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexa(propan-2-yl)-1,3-dioxan-2-one.
| Compound Name | 4,4,5,5,6,6-hexa(propan-2-yl)-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 164934214 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 4,4,5,5,6,6-hexa(propan-2-yl)-1,3-dioxan-2-one |
| SMILES | CC(C)C1(C(C)C)OC(=O)OC(C(C)C)(C(C)C)C1(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O3/c1-13(2)20(14(3)4)21(15(5)6,16(7)8)24-19(23)25-22(20,17(9)10)18(11)12/h13-18H,1-12H3 |
| InChIKey | AWRXBRHXPFFHAL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |