C21H18ClF2N5O2 — CID 164934980
N-[1-(6-chloro-3-pyridinyl)cyclobutyl]-6-[(2,6-difluoro-4-pyridinyl)amino]-3-methoxypyridine-2-carboxamide (PubChem CID 164934980) has the molecular formula C21H18ClF2N5O2 and a molecular weight of 445.86 g/mol. Its IUPAC name is N-[1-(6-chloro-3-pyridinyl)cyclobutyl]-6-[(2,6-difluoro-4-pyridinyl)amino]-3-methoxypyridine-2-carboxamide.
| Compound Name | N-[1-(6-chloro-3-pyridinyl)cyclobutyl]-6-[(2,6-difluoro-4-pyridinyl)amino]-3-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 164934980 |
| Molecular Formula | C21H18ClF2N5O2 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[1-(6-chloro-3-pyridinyl)cyclobutyl]-6-[(2,6-difluoro-4-pyridinyl)amino]-3-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(Nc2cc(F)nc(F)c2)nc1C(=O)NC1(c2ccc(Cl)nc2)CCC1 |
| InChI | InChI=1S/C21H18ClF2N5O2/c1-31-14-4-6-18(26-13-9-16(23)27-17(24)10-13)28-19(14)20(30)29-21(7-2-8-21)12-3-5-15(22)25-11-12/h3-6,9-11H,2,7-8H2,1H3,(H,29,30)(H,26,27,28) |
| InChIKey | NDDAWVBYFXWTNF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|