C14H24O5Si — CID 164935279
(4S,6aS)-6-methoxy-2,2-dimethyl-4'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one (PubChem CID 164935279) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is (4S,6aS)-6-methoxy-2,2-dimethyl-4'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one.
| Compound Name | (4S,6aS)-6-methoxy-2,2-dimethyl-4'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 164935279 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (4S,6aS)-6-methoxy-2,2-dimethyl-4'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
| SMILES | COC1O[C@@]2(CC([Si](C)(C)C)C2=O)C2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H24O5Si/c1-13(2)17-9-11(18-13)14(19-12(9)16-3)7-8(10(14)15)20(4,5)6/h8-9,11-12H,7H2,1-6H3/t8?,9-,11?,12?,14+/m0/s1 |
| InChIKey | GFCLRFGNQILYIA-CWABZXGYSA-N |
| XLogP | 1.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|