C13H22O5Si — CID 135072092
1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylpropane-1,3-dione (PubChem CID 135072092) has the molecular formula C13H22O5Si and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylpropane-1,3-dione.
| Compound Name | 1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylpropane-1,3-dione |
|---|---|
| PubChem CID | 135072092 |
| Molecular Formula | C13H22O5Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylpropane-1,3-dione |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)CC(=O)[Si](C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C13H22O5Si/c1-13(2)17-10-7-9(16-12(10)18-13)8(14)6-11(15)19(3,4)5/h9-10,12H,6-7H2,1-5H3/t9-,10+,12+/m0/s1 |
| InChIKey | OHYWKTGXFKSBMT-HOSYDEDBSA-N |
| XLogP | 1.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|