C23H28BClN8O3SY — CID 164935568
CID 164935568 (PubChem CID 164935568) has the molecular formula C23H28BClN8O3SY and a molecular weight of 631.77 g/mol.
| Compound Name | CID 164935568 |
|---|---|
| PubChem CID | 164935568 |
| Molecular Formula | C23H28BClN8O3SY |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | — |
| SMILES | Cc1nc(Nc2cnc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCO)CC2)n1.[H]/N=C(\[B])O.[Y] |
| InChI | InChI=1S/C22H26ClN7O2S.CH2BNO.Y/c1-14-4-3-5-16(23)20(14)28-21(32)22-24-13-19(33-22)27-17-12-18(26-15(2)25-17)30-8-6-29(7-9-30)10-11-31;2-1(3)4;/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,25,26,27);(H2,3,4); |
| InChIKey | IPOMZGVFXVNPKP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|