C23H28BFN5O3Y- — CID 164935595
CID 164935595 (PubChem CID 164935595) has the molecular formula C23H28BFN5O3Y- and a molecular weight of 541.23 g/mol.
| Compound Name | CID 164935595 |
|---|---|
| PubChem CID | 164935595 |
| Molecular Formula | C23H28BFN5O3Y- |
| Molecular Weight | 541.23 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | — |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)[N-]c3ccc(F)cc32)c1C.[H]/N=C(\[B])O.[Y] |
| InChI | InChI=1S/C22H27FN4O2.CH2BNO.Y/c1-5-27(6-2)10-9-24-22(29)20-13(3)19(25-14(20)4)12-17-16-11-15(23)7-8-18(16)26-21(17)28;2-1(3)4;/h7-8,11-12H,5-6,9-10H2,1-4H3,(H3,24,25,26,28,29);(H2,3,4);/p-1 |
| InChIKey | MZXOQQDSWNLCKG-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|