C15H13ClN6O — CID 164936180
5-[[1-(4-chlorophenyl)pyrazol-4-yl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 164936180) has the molecular formula C15H13ClN6O and a molecular weight of 328.76 g/mol. Its IUPAC name is 5-[[1-(4-chlorophenyl)pyrazol-4-yl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-[[1-(4-chlorophenyl)pyrazol-4-yl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 164936180 |
| Molecular Formula | C15H13ClN6O |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-[[1-(4-chlorophenyl)pyrazol-4-yl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N\O)c1ccc(Nc2cnn(-c3ccc(Cl)cc3)c2)cn1 |
| InChI | InChI=1S/C15H13ClN6O/c16-10-1-4-13(5-2-10)22-9-12(8-19-22)20-11-3-6-14(18-7-11)15(17)21-23/h1-9,20,23H,(H2,17,21) |
| InChIKey | VXOHGYVABSOUNX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|