C44H28N2O — CID 164936933
4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 164936933) has the molecular formula C44H28N2O and a molecular weight of 600.72 g/mol. Its IUPAC name is 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 164936933 |
| Molecular Formula | C44H28N2O |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-c5ccc6c(c5)-c5cccc7cccc(c57)O6)cc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H28N2O/c1-3-9-32(10-4-1)39-28-40(46-44(45-39)35-11-5-2-6-12-35)33-23-21-30(22-24-33)29-17-19-31(20-18-29)36-25-26-41-38(27-36)37-15-7-13-34-14-8-16-42(47-41)43(34)37/h1-28H |
| InChIKey | RISOLACOGRQNMJ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |