C48H30N2O — CID 164937180
4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)naphthalen-1-yl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 164937180) has the molecular formula C48H30N2O and a molecular weight of 650.78 g/mol. Its IUPAC name is 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)naphthalen-1-yl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)naphthalen-1-yl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 164937180 |
| Molecular Formula | C48H30N2O |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 4-[4-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)naphthalen-1-yl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-c5ccc6c(c5)-c5cccc7cccc(c57)O6)c5ccccc45)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C48H30N2O/c1-3-11-32(12-4-1)43-30-44(50-48(49-43)35-13-5-2-6-14-35)33-23-21-31(22-24-33)37-26-27-38(40-18-8-7-17-39(37)40)36-25-28-45-42(29-36)41-19-9-15-34-16-10-20-46(51-45)47(34)41/h1-30H |
| InChIKey | LTCCGJRHDSKIEM-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |