C40H27N3O — CID 164937269
2-(9,9-dimethylfluoren-4-yl)-4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-6-phenyl-1,3,5-triazine (PubChem CID 164937269) has the molecular formula C40H27N3O and a molecular weight of 565.68 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-4-yl)-4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-4-yl)-4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164937269 |
| Molecular Formula | C40H27N3O |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 2-(9,9-dimethylfluoren-4-yl)-4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)-c4cccc6cccc(c46)O5)n3)cccc21 |
| InChI | InChI=1S/C40H27N3O/c1-40(2)31-18-7-6-15-28(31)36-29(17-10-19-32(36)40)39-42-37(25-11-4-3-5-12-25)41-38(43-39)26-21-22-33-30(23-26)27-16-8-13-24-14-9-20-34(44-33)35(24)27/h3-23H,1-2H3 |
| InChIKey | FDXVVHRILJWVKR-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |