C41H28N2O — CID 164936996
4-(9,9-dimethylfluoren-3-yl)-6-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-2-phenylpyrimidine (PubChem CID 164936996) has the molecular formula C41H28N2O and a molecular weight of 564.69 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-3-yl)-6-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-2-phenylpyrimidine.
| Compound Name | 4-(9,9-dimethylfluoren-3-yl)-6-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-2-phenylpyrimidine |
|---|---|
| PubChem CID | 164936996 |
| Molecular Formula | C41H28N2O |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 4-(9,9-dimethylfluoren-3-yl)-6-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)-2-phenylpyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cc(-c4ccc5c(c4)-c4cccc6cccc(c46)O5)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C41H28N2O/c1-41(2)33-16-7-6-14-29(33)31-22-27(18-20-34(31)41)35-24-36(43-40(42-35)26-10-4-3-5-11-26)28-19-21-37-32(23-28)30-15-8-12-25-13-9-17-38(44-37)39(25)30/h3-24H,1-2H3 |
| InChIKey | PKHYBIWPVZQSKO-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |