C31H53N2O2+ — CID 164938762
(2S,10S,13S,16S,17R)-10,13,17-trimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 164938762) has the molecular formula C31H53N2O2+ and a molecular weight of 485.78 g/mol. Its IUPAC name is (2S,10S,13S,16S,17R)-10,13,17-trimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (2S,10S,13S,16S,17R)-10,13,17-trimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 164938762 |
| Molecular Formula | C31H53N2O2+ |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 485.41 |
| IUPAC Name | (2S,10S,13S,16S,17R)-10,13,17-trimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=CC[N+]1([C@H]2CC3C4CCC5CC(O)[C@@H](N6CCOCC6)C[C@]5(C)C4CC[C@]3(C)[C@H]2C)CCCC1 |
| InChI | InChI=1S/C31H53N2O2/c1-5-14-33(15-6-7-16-33)28-20-26-24-9-8-23-19-29(34)27(32-12-17-35-18-13-32)21-31(23,4)25(24)10-11-30(26,3)22(28)2/h5,22-29,34H,1,6-21H2,2-4H3/q+1/t22-,23?,24?,25?,26?,27-,28-,29?,30+,31-/m0/s1 |
| InChIKey | CQQBMDVMHREDPL-ATLLFKRJSA-N |
| XLogP | 5.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|