C29H49N2O3+ — CID 58589576
(2S,3S,5S,10S,13S,16S)-10-methyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,13-diol (PubChem CID 58589576) has the molecular formula C29H49N2O3+ and a molecular weight of 473.72 g/mol. Its IUPAC name is (2S,3S,5S,10S,13S,16S)-10-methyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,13-diol.
| Compound Name | (2S,3S,5S,10S,13S,16S)-10-methyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,13-diol |
|---|---|
| PubChem CID | 58589576 |
| Molecular Formula | C29H49N2O3+ |
| Molecular Weight | 473.72 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | (2S,3S,5S,10S,13S,16S)-10-methyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,13-diol |
| SMILES | C=CC[N+]1([C@H]2CC3C4CC[C@H]5C[C@H](O)[C@@H](N6CCOCC6)C[C@]5(C)C4CC[C@]3(O)C2)CCCC1 |
| InChI | InChI=1S/C29H49N2O3/c1-3-12-31(13-4-5-14-31)22-18-25-23-7-6-21-17-27(32)26(30-10-15-34-16-11-30)20-28(21,2)24(23)8-9-29(25,33)19-22/h3,21-27,32-33H,1,4-20H2,2H3/q+1/t21-,22-,23?,24?,25?,26-,27-,28-,29-/m0/s1 |
| InChIKey | UCLDPLWCAVQKRZ-KAKDDJBBSA-N |
| XLogP | 3.59 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|