C32H53N2O4+ — CID 66524521
[(10S,13R)-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-9-yl] acetate (PubChem CID 66524521) has the molecular formula C32H53N2O4+ and a molecular weight of 529.79 g/mol. Its IUPAC name is [(10S,13R)-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-9-yl] acetate.
| Compound Name | [(10S,13R)-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 66524521 |
| Molecular Formula | C32H53N2O4+ |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.40 |
| IUPAC Name | [(10S,13R)-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-9-yl] acetate |
| SMILES | C=CC[N+]1(C2CC3C4CCC5CC(O)C(N6CCOCC6)C[C@]5(C)C4(OC(C)=O)CC[C@]3(C)C2)CCCC1 |
| InChI | InChI=1S/C32H53N2O4/c1-5-14-34(15-6-7-16-34)25-20-27-26-9-8-24-19-29(36)28(33-12-17-37-18-13-33)22-31(24,4)32(26,38-23(2)35)11-10-30(27,3)21-25/h5,24-29,36H,1,6-22H2,2-4H3/q+1/t24?,25?,26?,27?,28?,29?,30-,31+,32?/m1/s1 |
| InChIKey | IOJWVSYRNKCBQD-SXELYZAHSA-N |
| XLogP | 4.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|