C24H19F2NOS — CID 164939786
2-[3,5-difluoro-2-[(E)-2-methoxyethenyl]phenyl]-7-(3,5-dimethylphenyl)thieno[2,3-c]pyridine (PubChem CID 164939786) has the molecular formula C24H19F2NOS and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-[3,5-difluoro-2-[(E)-2-methoxyethenyl]phenyl]-7-(3,5-dimethylphenyl)thieno[2,3-c]pyridine.
| Compound Name | 2-[3,5-difluoro-2-[(E)-2-methoxyethenyl]phenyl]-7-(3,5-dimethylphenyl)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 164939786 |
| Molecular Formula | C24H19F2NOS |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[3,5-difluoro-2-[(E)-2-methoxyethenyl]phenyl]-7-(3,5-dimethylphenyl)thieno[2,3-c]pyridine |
| SMILES | CO/C=C/c1c(F)cc(F)cc1-c1cc2ccnc(-c3cc(C)cc(C)c3)c2s1 |
| InChI | InChI=1S/C24H19F2NOS/c1-14-8-15(2)10-17(9-14)23-24-16(4-6-27-23)11-22(29-24)20-12-18(25)13-21(26)19(20)5-7-28-3/h4-13H,1-3H3/b7-5+ |
| InChIKey | KSFBPKKDMSEYND-FNORWQNLSA-N |
| XLogP | 7.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|