C26H25N3O4 — CID 164940233
1-[(1R)-3-oxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide (PubChem CID 164940233) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 1-[(1R)-3-oxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide.
| Compound Name | 1-[(1R)-3-oxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide |
|---|---|
| PubChem CID | 164940233 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 1-[(1R)-3-oxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide |
| SMILES | NC(=O)c1ccc2nc3c(cc2c1[C@H](CC=O)c1ccc(N2CCOC2=O)cc1)CCCC3 |
| InChI | InChI=1S/C26H25N3O4/c27-25(31)20-9-10-23-21(15-17-3-1-2-4-22(17)28-23)24(20)19(11-13-30)16-5-7-18(8-6-16)29-12-14-33-26(29)32/h5-10,13,15,19H,1-4,11-12,14H2,(H2,27,31)/t19-/m1/s1 |
| InChIKey | CJRKJOHAQGOYGO-LJQANCHMSA-N |
| XLogP | 3.89 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|