C45H86NO8P — CID 164941972
2,3-bis[8-(2-octylcyclopropyl)octanoyloxy]propyl (trimethylazaniumyl)methyl phosphate (PubChem CID 164941972) has the molecular formula C45H86NO8P and a molecular weight of 800.16 g/mol. Its IUPAC name is 2,3-bis[8-(2-octylcyclopropyl)octanoyloxy]propyl (trimethylazaniumyl)methyl phosphate.
| Compound Name | 2,3-bis[8-(2-octylcyclopropyl)octanoyloxy]propyl (trimethylazaniumyl)methyl phosphate |
|---|---|
| PubChem CID | 164941972 |
| Molecular Formula | C45H86NO8P |
| Molecular Weight | 800.16 g/mol |
| Exact Mass | 799.61 |
| IUPAC Name | 2,3-bis[8-(2-octylcyclopropyl)octanoyloxy]propyl (trimethylazaniumyl)methyl phosphate |
| SMILES | CCCCCCCCC1CC1CCCCCCCC(=O)OCC(COP(=O)([O-])OC[N+](C)(C)C)OC(=O)CCCCCCCC1CC1CCCCCCCC |
| InChI | InChI=1S/C45H86NO8P/c1-6-8-10-12-16-22-28-39-34-41(39)30-24-18-14-20-26-32-44(47)51-36-43(37-52-55(49,50)53-38-46(3,4)5)54-45(48)33-27-21-15-19-25-31-42-35-40(42)29-23-17-13-11-9-7-2/h39-43H,6-38H2,1-5H3 |
| InChIKey | KAWKXIDKHKMJQN-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.16 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|