C57H35N3O2 — CID 164942380
2-[4-[3,5-di(dibenzofuran-3-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 164942380) has the molecular formula C57H35N3O2 and a molecular weight of 793.93 g/mol. Its IUPAC name is 2-[4-[3,5-di(dibenzofuran-3-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[3,5-di(dibenzofuran-3-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164942380 |
| Molecular Formula | C57H35N3O2 |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 793.27 |
| IUPAC Name | 2-[4-[3,5-di(dibenzofuran-3-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cc(-c5ccc6c(c5)oc5ccccc56)cc(-c5ccc6c(c5)oc5ccccc56)c4)cc3)nc(-c3ccccc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C57H35N3O2/c1-3-13-37(14-4-1)45-17-7-8-20-50(45)57-59-55(38-15-5-2-6-16-38)58-56(60-57)39-25-23-36(24-26-39)42-31-43(40-27-29-48-46-18-9-11-21-51(46)61-53(48)34-40)33-44(32-42)41-28-30-49-47-19-10-12-22-52(47)62-54(49)35-41/h1-35H |
| InChIKey | OCBSAACJRCFINW-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |