C40H25N3O2 — CID 155281558
3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]xanthen-9-one (PubChem CID 155281558) has the molecular formula C40H25N3O2 and a molecular weight of 579.66 g/mol. Its IUPAC name is 3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]xanthen-9-one.
| Compound Name | 3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 155281558 |
| Molecular Formula | C40H25N3O2 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2cc(-c3ccc(-c4ccccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc12 |
| InChI | InChI=1S/C40H25N3O2/c44-37-33-17-9-10-18-35(33)45-36-25-30(23-24-34(36)37)26-19-21-27(22-20-26)31-15-7-8-16-32(31)40-42-38(28-11-3-1-4-12-28)41-39(43-40)29-13-5-2-6-14-29/h1-25H |
| InChIKey | VKFMLHXWXNDDTB-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|