C34H21N3O2 — CID 155281538
3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]xanthen-9-one (PubChem CID 155281538) has the molecular formula C34H21N3O2 and a molecular weight of 503.56 g/mol. Its IUPAC name is 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]xanthen-9-one.
| Compound Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 155281538 |
| Molecular Formula | C34H21N3O2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2cc(-c3ccccc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C34H21N3O2/c38-31-27-17-9-10-18-29(27)39-30-21-24(19-20-28(30)31)25-15-7-8-16-26(25)34-36-32(22-11-3-1-4-12-22)35-33(37-34)23-13-5-2-6-14-23/h1-21H |
| InChIKey | NPYYJZRFGPOFDT-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|