C27H16ClN3O — CID 166741775
2-(2-chlorophenyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine (PubChem CID 166741775) has the molecular formula C27H16ClN3O and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(2-chlorophenyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166741775 |
| Molecular Formula | C27H16ClN3O |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(2-chlorophenyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine |
| SMILES | Clc1ccccc1-c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C27H16ClN3O/c28-22-12-6-4-11-21(22)27-30-25(17-8-2-1-3-9-17)29-26(31-27)18-14-15-20-19-10-5-7-13-23(19)32-24(20)16-18/h1-16H |
| InChIKey | WFUJBOFBUWFMMS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |