C49H30N3Se2 — CID 164943605
CID 164943605 (PubChem CID 164943605) has the molecular formula C49H30N3Se2 and a molecular weight of 818.72 g/mol.
| Compound Name | CID 164943605 |
|---|---|
| PubChem CID | 164943605 |
| Molecular Formula | C49H30N3Se2 |
| Molecular Weight | 818.72 g/mol |
| Exact Mass | 820.08 |
| IUPAC Name | — |
| SMILES | [Se]c1c(-c2cccc(-c3ccccc3)c2)cccc1-c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3[se]c3ccccc34)n2)c2ccccc12 |
| InChI | InChI=1S/C49H30N3Se2/c53-45-35(34-19-11-18-33(30-34)31-14-3-1-4-15-31)23-12-24-40(45)38-28-29-42(37-21-8-7-20-36(37)38)48-50-47(32-16-5-2-6-17-32)51-49(52-48)43-26-13-25-41-39-22-9-10-27-44(39)54-46(41)43/h1-30H |
| InChIKey | WCPOKLVHHPSSKW-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.72 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|