C66H44BClN6O2Se2 — CID 167688723
2-chloro-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;dibenzoselenophen-4-ylboronic acid;2-dibenzoselenophen-4-yl-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 167688723) has the molecular formula C66H44BClN6O2Se2 and a molecular weight of 1157.30 g/mol. Its IUPAC name is 2-chloro-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;dibenzoselenophen-4-ylboronic acid;2-dibenzoselenophen-4-yl-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;dibenzoselenophen-4-ylboronic acid;2-dibenzoselenophen-4-yl-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167688723 |
| Molecular Formula | C66H44BClN6O2Se2 |
| Molecular Weight | 1157.30 g/mol |
| Exact Mass | 1158.16 |
| IUPAC Name | 2-chloro-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine;dibenzoselenophen-4-ylboronic acid;2-dibenzoselenophen-4-yl-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc(-c3ccccc3)cc2)n1.OB(O)c1cccc2c1[se]c1ccccc12.c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4[se]c4ccccc45)n3)cc2)cc1 |
| InChI | InChI=1S/C33H21N3Se.C21H14ClN3.C12H9BO2Se/c1-3-10-22(11-4-1)23-18-20-25(21-19-23)32-34-31(24-12-5-2-6-13-24)35-33(36-32)28-16-9-15-27-26-14-7-8-17-29(26)37-30(27)28;22-21-24-19(17-9-5-2-6-10-17)23-20(25-21)18-13-11-16(12-14-18)15-7-3-1-4-8-15;14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-21H;1-14H;1-7,14-15H |
| InChIKey | WPIQUPHAQQZFJO-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1157.30 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|