C54H38BCl3N6O2 — CID 158875121
2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine;(2-phenylphenyl)boronic acid (PubChem CID 158875121) has the molecular formula C54H38BCl3N6O2 and a molecular weight of 920.11 g/mol. Its IUPAC name is 2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine;(2-phenylphenyl)boronic acid.
| Compound Name | 2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine;(2-phenylphenyl)boronic acid |
|---|---|
| PubChem CID | 158875121 |
| Molecular Formula | C54H38BCl3N6O2 |
| Molecular Weight | 920.11 g/mol |
| Exact Mass | 918.22 |
| IUPAC Name | 2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine;(2-phenylphenyl)boronic acid |
| SMILES | Clc1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccccc2-c2ccccc2)n1.Clc1nc(Cl)nc(-c2ccc(-c3ccccc3)cc2)n1.OB(O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H18ClN3.C15H9Cl2N3.C12H11BO2/c28-27-30-25(22-17-15-20(16-18-22)19-9-3-1-4-10-19)29-26(31-27)24-14-8-7-13-23(24)21-11-5-2-6-12-21;16-14-18-13(19-15(17)20-14)12-8-6-11(7-9-12)10-4-2-1-3-5-10;14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-18H;1-9H;1-9,14-15H |
| InChIKey | JCIMNLBKKAJHLC-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.11 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|