C43H28N3Se — CID 164943651
CID 164943651 (PubChem CID 164943651) has the molecular formula C43H28N3Se and a molecular weight of 665.68 g/mol.
| Compound Name | CID 164943651 |
|---|---|
| PubChem CID | 164943651 |
| Molecular Formula | C43H28N3Se |
| Molecular Weight | 665.68 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | — |
| SMILES | [Se]c1ccc(-c2cccc3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc23)cc1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C43H28N3Se/c47-40-25-24-35(27-39(40)34-20-10-19-33(26-34)29-12-4-1-5-13-29)37-21-11-18-30-22-23-36(28-38(30)37)43-45-41(31-14-6-2-7-15-31)44-42(46-43)32-16-8-3-9-17-32/h1-28H |
| InChIKey | UDRVMSPIFSJHHB-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.68 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|