About 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline
6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline (PubChem CID 164944255) has the molecular formula C12H12BrN3
and a molecular weight of 278.15 g/mol. Its IUPAC name is 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline.
Molecular Properties
| Compound Name | 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline |
| PubChem CID | 164944255 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline |
| SMILES | CN1Cc2cn(C)nc2-c2cccc(Br)c21 |
| InChI | InChI=1S/C12H12BrN3/c1-15-6-8-7-16(2)14-11(8)9-4-3-5-10(13)12(9)15/h3-5,7H,6H2,1-2H3 |
| InChIKey | ZEXCEMREGWSTTF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline?
The IUPAC name of 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline (CID 164944255) is 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline.
What is the SMILES notation for 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline?
The canonical SMILES for 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline is CN1Cc2cn(C)nc2-c2cccc(Br)c21.
What is the InChIKey of 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline?
The InChIKey is ZEXCEMREGWSTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN3/c1-15-6-8-7-16(2)14-11(8)9-4-3-5-10(13)12(9)15/h3-5,7H,6H2,1-2H3.
What are the key properties of 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline?
6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline has a molecular weight of 278.15 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,5-dimethyl-4H-pyrazolo[4,3-c]quinoline is sourced from PubChem (CID 164944255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).