C20H22F2N4O — CID 164944573
(E)-4-[2-amino-5-[(3,5-difluorophenyl)methylamino]phenyl]-4-imino-N-propan-2-ylbut-2-enamide (PubChem CID 164944573) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is (E)-4-[2-amino-5-[(3,5-difluorophenyl)methylamino]phenyl]-4-imino-N-propan-2-ylbut-2-enamide.
| Compound Name | (E)-4-[2-amino-5-[(3,5-difluorophenyl)methylamino]phenyl]-4-imino-N-propan-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 164944573 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (E)-4-[2-amino-5-[(3,5-difluorophenyl)methylamino]phenyl]-4-imino-N-propan-2-ylbut-2-enamide |
| SMILES | [H]/N=C(\C=C\C(=O)NC(C)C)c1cc(NCc2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C20H22F2N4O/c1-12(2)26-20(27)6-5-19(24)17-10-16(3-4-18(17)23)25-11-13-7-14(21)9-15(22)8-13/h3-10,12,24-25H,11,23H2,1-2H3,(H,26,27)/b6-5+,24-19+ |
| InChIKey | XEKAMIUQGAZGLB-CNYZNGRTSA-N |
| XLogP | 3.61 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|