C21H21F3N8O3 — CID 164945221
4-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide (PubChem CID 164945221) has the molecular formula C21H21F3N8O3 and a molecular weight of 490.45 g/mol. Its IUPAC name is 4-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide.
| Compound Name | 4-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 164945221 |
| Molecular Formula | C21H21F3N8O3 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NCc2cccc(OC(F)(F)F)c2)nc1CCC(=O)N1CCc2n[nH]nc2C1 |
| InChI | InChI=1S/C21H21F3N8O3/c22-21(23,24)35-13-3-1-2-12(8-13)9-26-20-27-10-14(19(25)34)15(28-20)4-5-18(33)32-7-6-16-17(11-32)30-31-29-16/h1-3,8,10H,4-7,9,11H2,(H2,25,34)(H,26,27,28)(H,29,30,31) |
| InChIKey | YPQAGKYPVKDSFO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |