C16H14F3N3O4 — CID 167856689
7-[2-[3-(trifluoromethoxy)phenyl]acetyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione (PubChem CID 167856689) has the molecular formula C16H14F3N3O4 and a molecular weight of 369.30 g/mol. Its IUPAC name is 7-[2-[3-(trifluoromethoxy)phenyl]acetyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 7-[2-[3-(trifluoromethoxy)phenyl]acetyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167856689 |
| Molecular Formula | C16H14F3N3O4 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 7-[2-[3-(trifluoromethoxy)phenyl]acetyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)N1CCc2c([nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C16H14F3N3O4/c17-16(18,19)26-10-3-1-2-9(6-10)7-13(23)22-5-4-11-12(8-22)20-15(25)21-14(11)24/h1-3,6H,4-5,7-8H2,(H2,20,21,24,25) |
| InChIKey | PBYVZPCIPRESIQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |