C15H13BrIN3O3 — CID 166377771
6-[2-(3-bromo-5-iodophenyl)acetyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 166377771) has the molecular formula C15H13BrIN3O3 and a molecular weight of 490.10 g/mol. Its IUPAC name is 6-[2-(3-bromo-5-iodophenyl)acetyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[2-(3-bromo-5-iodophenyl)acetyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166377771 |
| Molecular Formula | C15H13BrIN3O3 |
| Molecular Weight | 490.10 g/mol |
| Exact Mass | 488.92 |
| IUPAC Name | 6-[2-(3-bromo-5-iodophenyl)acetyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | O=C(Cc1cc(Br)cc(I)c1)N1CCc2[nH]c(=O)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C15H13BrIN3O3/c16-9-3-8(4-10(17)6-9)5-13(21)20-2-1-12-11(7-20)14(22)19-15(23)18-12/h3-4,6H,1-2,5,7H2,(H2,18,19,22,23) |
| InChIKey | BMRDOXBCBFMVKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|